C13H18O4 — CID 117349180
1-[(2,3,4-trimethoxyphenyl)methyl]cyclopropan-1-ol (PubChem CID 117349180) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is 1-[(2,3,4-trimethoxyphenyl)methyl]cyclopropan-1-ol.
| Compound Name | 1-[(2,3,4-trimethoxyphenyl)methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117349180 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 1-[(2,3,4-trimethoxyphenyl)methyl]cyclopropan-1-ol |
| SMILES | COc1ccc(CC2(O)CC2)c(OC)c1OC |
| InChI | InChI=1S/C13H18O4/c1-15-10-5-4-9(8-13(14)6-7-13)11(16-2)12(10)17-3/h4-5,14H,6-8H2,1-3H3 |
| InChIKey | NELCJWVEDWVJAR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |