C13H22N2O2 — CID 117349624
4-(1-aminopropan-2-yl)-2,5-dimethoxy-N,N-dimethylaniline (PubChem CID 117349624) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4-(1-aminopropan-2-yl)-2,5-dimethoxy-N,N-dimethylaniline.
| Compound Name | 4-(1-aminopropan-2-yl)-2,5-dimethoxy-N,N-dimethylaniline |
|---|---|
| PubChem CID | 117349624 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4-(1-aminopropan-2-yl)-2,5-dimethoxy-N,N-dimethylaniline |
| SMILES | COc1cc(N(C)C)c(OC)cc1C(C)CN |
| InChI | InChI=1S/C13H22N2O2/c1-9(8-14)10-6-13(17-5)11(15(2)3)7-12(10)16-4/h6-7,9H,8,14H2,1-5H3 |
| InChIKey | XVLSVWQWGZBICG-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |