C10H10ClF3O — CID 117349702
2-[2-chloro-5-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 117349702) has the molecular formula C10H10ClF3O and a molecular weight of 238.64 g/mol. Its IUPAC name is 2-[2-chloro-5-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117349702 |
| Molecular Formula | C10H10ClF3O |
| Molecular Weight | 238.64 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-[2-chloro-5-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC(CO)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H10ClF3O/c1-6(5-15)8-4-7(10(12,13)14)2-3-9(8)11/h2-4,6,15H,5H2,1H3 |
| InChIKey | YHSGIHARBFEWFR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |