About N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine
N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine (PubChem CID 117350669) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine.
Molecular Properties
| Compound Name | N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine |
| PubChem CID | 117350669 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine |
| SMILES | COCc1cc2c(cc1CNOC)OCCO2 |
| InChI | InChI=1S/C12H17NO4/c1-14-8-10-6-12-11(16-3-4-17-12)5-9(10)7-13-15-2/h5-6,13H,3-4,7-8H2,1-2H3 |
| InChIKey | ACRAHVYTZBQUJR-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine?
The IUPAC name of N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine (CID 117350669) is N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine.
What is the SMILES notation for N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine?
The canonical SMILES for N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine is COCc1cc2c(cc1CNOC)OCCO2.
What is the InChIKey of N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine?
The InChIKey is ACRAHVYTZBQUJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-14-8-10-6-12-11(16-3-4-17-12)5-9(10)7-13-15-2/h5-6,13H,3-4,7-8H2,1-2H3.
What are the key properties of N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine?
N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine has a molecular weight of 239.27 g/mol, XLogP of 1.26, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methoxy-1-[6-(methoxymethyl)-2,3-dihydro-1,4-benzodioxin-7-yl]methanamine is sourced from PubChem (CID 117350669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).