C14H19F2N — CID 117351181
2-[4-(2,2-difluoropropyl)phenyl]-2-methylpyrrolidine (PubChem CID 117351181) has the molecular formula C14H19F2N and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-[4-(2,2-difluoropropyl)phenyl]-2-methylpyrrolidine.
| Compound Name | 2-[4-(2,2-difluoropropyl)phenyl]-2-methylpyrrolidine |
|---|---|
| PubChem CID | 117351181 |
| Molecular Formula | C14H19F2N |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-[4-(2,2-difluoropropyl)phenyl]-2-methylpyrrolidine |
| SMILES | CC(F)(F)Cc1ccc(C2(C)CCCN2)cc1 |
| InChI | InChI=1S/C14H19F2N/c1-13(8-3-9-17-13)12-6-4-11(5-7-12)10-14(2,15)16/h4-7,17H,3,8-10H2,1-2H3 |
| InChIKey | VWSGASCDRNNLOU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |