C35H69NO8Si3 — CID 11735208
tert-butyl (1S,2R,3S,7S,8S,9S,10R)-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecane-12-carboxylate (PubChem CID 11735208) has the molecular formula C35H69NO8Si3 and a molecular weight of 716.19 g/mol. Its IUPAC name is tert-butyl (1S,2R,3S,7S,8S,9S,10R)-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecane-12-carboxylate.
| Compound Name | tert-butyl (1S,2R,3S,7S,8S,9S,10R)-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecane-12-carboxylate |
|---|---|
| PubChem CID | 11735208 |
| Molecular Formula | C35H69NO8Si3 |
| Molecular Weight | 716.19 g/mol |
| Exact Mass | 715.43 |
| IUPAC Name | tert-butyl (1S,2R,3S,7S,8S,9S,10R)-2,8,9-tris[[tert-butyl(dimethyl)silyl]oxy]-5,5-dimethyl-11-oxo-4,6-dioxa-12-azatricyclo[8.2.1.03,7]tridecane-12-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@@H]2C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C35H69NO8Si3/c1-31(2,3)41-30(38)36-23-21-22(29(36)37)24(42-45(15,16)32(4,5)6)28(44-47(19,20)34(10,11)12)27-26(39-35(13,14)40-27)25(23)43-46(17,18)33(7,8)9/h22-28H,21H2,1-20H3/t22-,23+,24+,25-,26-,27+,28-/m1/s1 |
| InChIKey | FUFSJFUBMZOBFI-MGNMCWALSA-N |
| XLogP | 8.84 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.19 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|