C13H14F2O2 — CID 117352883
1-[2-(2,2-difluoroethyl)phenyl]cyclobutane-1-carboxylic acid (PubChem CID 117352883) has the molecular formula C13H14F2O2 and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-[2-(2,2-difluoroethyl)phenyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[2-(2,2-difluoroethyl)phenyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117352883 |
| Molecular Formula | C13H14F2O2 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-[2-(2,2-difluoroethyl)phenyl]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ccccc2CC(F)F)CCC1 |
| InChI | InChI=1S/C13H14F2O2/c14-11(15)8-9-4-1-2-5-10(9)13(12(16)17)6-3-7-13/h1-2,4-5,11H,3,6-8H2,(H,16,17) |
| InChIKey | OALRZWXJIIBCHL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |