C13H20O4 — CID 117353545
2-[4,5-dimethoxy-2-(methoxymethyl)phenyl]propan-1-ol (PubChem CID 117353545) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-[4,5-dimethoxy-2-(methoxymethyl)phenyl]propan-1-ol.
| Compound Name | 2-[4,5-dimethoxy-2-(methoxymethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 117353545 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-[4,5-dimethoxy-2-(methoxymethyl)phenyl]propan-1-ol |
| SMILES | COCc1cc(OC)c(OC)cc1C(C)CO |
| InChI | InChI=1S/C13H20O4/c1-9(7-14)11-6-13(17-4)12(16-3)5-10(11)8-15-2/h5-6,9,14H,7-8H2,1-4H3 |
| InChIKey | HLSCSSYUNDPMSZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |