About 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol
2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol (PubChem CID 117354297) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol |
| PubChem CID | 117354297 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol |
| SMILES | OCCc1cc(Br)cc2c1CCC2 |
| InChI | InChI=1S/C11H13BrO/c12-10-6-8-2-1-3-11(8)9(7-10)4-5-13/h6-7,13H,1-5H2 |
| InChIKey | UJLSPEMXTMYOEN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol?
The IUPAC name of 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol (CID 117354297) is 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol.
What is the SMILES notation for 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol?
The canonical SMILES for 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol is OCCc1cc(Br)cc2c1CCC2.
What is the InChIKey of 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol?
The InChIKey is UJLSPEMXTMYOEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c12-10-6-8-2-1-3-11(8)9(7-10)4-5-13/h6-7,13H,1-5H2.
What are the key properties of 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol?
2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol has a molecular weight of 241.13 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-2,3-dihydro-1H-inden-4-yl)ethanol is sourced from PubChem (CID 117354297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).