C13H11N3O2 — CID 117354699
5-(1-methoxyisoquinolin-6-yl)-1,2-oxazol-3-amine (PubChem CID 117354699) has the molecular formula C13H11N3O2 and a molecular weight of 241.25 g/mol. Its IUPAC name is 5-(1-methoxyisoquinolin-6-yl)-1,2-oxazol-3-amine.
| Compound Name | 5-(1-methoxyisoquinolin-6-yl)-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117354699 |
| Molecular Formula | C13H11N3O2 |
| Molecular Weight | 241.25 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 5-(1-methoxyisoquinolin-6-yl)-1,2-oxazol-3-amine |
| SMILES | COc1nccc2cc(-c3cc(N)no3)ccc12 |
| InChI | InChI=1S/C13H11N3O2/c1-17-13-10-3-2-9(6-8(10)4-5-15-13)11-7-12(14)16-18-11/h2-7H,1H3,(H2,14,16) |
| InChIKey | PTMKUFVWWTVWGI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |