C30H48O18P4 — CID 11735474
bis(prop-2-enyl) [(1S,2R,3R,4S,5R,6S)-2,3,4-tris[bis(prop-2-enoxy)phosphoryloxy]-5,6-dihydroxycyclohexyl] phosphate (PubChem CID 11735474) has the molecular formula C30H48O18P4 and a molecular weight of 820.59 g/mol. Its IUPAC name is bis(prop-2-enyl) [(1S,2R,3R,4S,5R,6S)-2,3,4-tris[bis(prop-2-enoxy)phosphoryloxy]-5,6-dihydroxycyclohexyl] phosphate.
| Compound Name | bis(prop-2-enyl) [(1S,2R,3R,4S,5R,6S)-2,3,4-tris[bis(prop-2-enoxy)phosphoryloxy]-5,6-dihydroxycyclohexyl] phosphate |
|---|---|
| PubChem CID | 11735474 |
| Molecular Formula | C30H48O18P4 |
| Molecular Weight | 820.59 g/mol |
| Exact Mass | 820.18 |
| IUPAC Name | bis(prop-2-enyl) [(1S,2R,3R,4S,5R,6S)-2,3,4-tris[bis(prop-2-enoxy)phosphoryloxy]-5,6-dihydroxycyclohexyl] phosphate |
| SMILES | C=CCOP(=O)(OCC=C)OC1[C@@H](OP(=O)(OCC=C)OCC=C)[C@H](OP(=O)(OCC=C)OCC=C)[C@@H](OP(=O)(OCC=C)OCC=C)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H48O18P4/c1-9-17-37-49(33,38-18-10-2)45-27-25(31)26(32)28(46-50(34,39-19-11-3)40-20-12-4)30(48-52(36,43-23-15-7)44-24-16-8)29(27)47-51(35,41-21-13-5)42-22-14-6/h9-16,25-32H,1-8,17-24H2/t25-,26+,27-,28?,29+,30+/m0/s1 |
| InChIKey | DIQNCIRBIORJNS-ZEZQHQGRSA-N |
| XLogP | 6.32 |
| TPSA | 219.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.59 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|