About 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one
6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one (PubChem CID 11735555) has the molecular formula C9H12O4
and a molecular weight of 184.19 g/mol. Its IUPAC name is 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one.
Molecular Properties
| Compound Name | 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one |
| PubChem CID | 11735555 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one |
| SMILES | CC1(C)OCC2(O1)C(=O)C=CC2O |
| InChI | InChI=1S/C9H12O4/c1-8(2)12-5-9(13-8)6(10)3-4-7(9)11/h3-4,6,10H,5H2,1-2H3 |
| InChIKey | CDIRCUFRKQSQKJ-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one?
The IUPAC name of 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one (CID 11735555) is 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one.
What is the SMILES notation for 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one?
The canonical SMILES for 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one is CC1(C)OCC2(O1)C(=O)C=CC2O.
What is the InChIKey of 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one?
The InChIKey is CDIRCUFRKQSQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O4/c1-8(2)12-5-9(13-8)6(10)3-4-7(9)11/h3-4,6,10H,5H2,1-2H3.
What are the key properties of 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one?
6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one has a molecular weight of 184.19 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-2,2-dimethyl-1,3-dioxaspiro[4.4]non-7-en-9-one is sourced from PubChem (CID 11735555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).