About 2-(2-phenylethynyl)-1,3-thiazole
2-(2-phenylethynyl)-1,3-thiazole (PubChem CID 11735574) has the molecular formula C11H7NS
and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-(2-phenylethynyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(2-phenylethynyl)-1,3-thiazole |
| PubChem CID | 11735574 |
| Molecular Formula | C11H7NS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2-(2-phenylethynyl)-1,3-thiazole |
| SMILES | C(#Cc1nccs1)c1ccccc1 |
| InChI | InChI=1S/C11H7NS/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11/h1-5,8-9H |
| InChIKey | UQGBBQTUUWZZFY-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-phenylethynyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethynyl)-1,3-thiazole?
The IUPAC name of 2-(2-phenylethynyl)-1,3-thiazole (CID 11735574) is 2-(2-phenylethynyl)-1,3-thiazole.
What is the SMILES notation for 2-(2-phenylethynyl)-1,3-thiazole?
The canonical SMILES for 2-(2-phenylethynyl)-1,3-thiazole is C(#Cc1nccs1)c1ccccc1.
What is the InChIKey of 2-(2-phenylethynyl)-1,3-thiazole?
The InChIKey is UQGBBQTUUWZZFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NS/c1-2-4-10(5-3-1)6-7-11-12-8-9-13-11/h1-5,8-9H.
What are the key properties of 2-(2-phenylethynyl)-1,3-thiazole?
2-(2-phenylethynyl)-1,3-thiazole has a molecular weight of 185.25 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethynyl)-1,3-thiazole is sourced from PubChem (CID 11735574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).