ethoxy(phenyl)phosphinic acid

C8H11O3P — CID 11735579

IUPACethoxy(phenyl)phosphinic acid
SMILESCCOP(=O)(O)c1ccccc1
InChIInChI=1S/C8H11O3P/c1-2-11-12(9,10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,9,10)
InChIKeyMWQBWSPPTQGZII-UHFFFAOYSA-N
MW186.15 g/mol
LogP1.53
Rot. Bonds3

About ethoxy(phenyl)phosphinic acid

ethoxy(phenyl)phosphinic acid (PubChem CID 11735579) has the molecular formula C8H11O3P and a molecular weight of 186.15 g/mol. Its IUPAC name is ethoxy(phenyl)phosphinic acid.

Molecular Properties

Compound Nameethoxy(phenyl)phosphinic acid
PubChem CID11735579
Molecular FormulaC8H11O3P
Molecular Weight186.15 g/mol
Exact Mass186.04
IUPAC Nameethoxy(phenyl)phosphinic acid
SMILESCCOP(=O)(O)c1ccccc1
InChIInChI=1S/C8H11O3P/c1-2-11-12(9,10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,9,10)
InChIKeyMWQBWSPPTQGZII-UHFFFAOYSA-N
XLogP1.53
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.15
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze ethoxy(phenyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethoxy(phenyl)phosphinic acid?
The IUPAC name of ethoxy(phenyl)phosphinic acid (CID 11735579) is ethoxy(phenyl)phosphinic acid.
What is the SMILES notation for ethoxy(phenyl)phosphinic acid?
The canonical SMILES for ethoxy(phenyl)phosphinic acid is CCOP(=O)(O)c1ccccc1.
What is the InChIKey of ethoxy(phenyl)phosphinic acid?
The InChIKey is MWQBWSPPTQGZII-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11O3P/c1-2-11-12(9,10)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,9,10).
What are the key properties of ethoxy(phenyl)phosphinic acid?
ethoxy(phenyl)phosphinic acid has a molecular weight of 186.15 g/mol, XLogP of 1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxy(phenyl)phosphinic acid is sourced from PubChem (CID 11735579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).