C10H18O3 — CID 11735589
(3S,4S)-4-cyclohexyl-3,4-dihydroxybutan-2-one (PubChem CID 11735589) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (3S,4S)-4-cyclohexyl-3,4-dihydroxybutan-2-one.
| Compound Name | (3S,4S)-4-cyclohexyl-3,4-dihydroxybutan-2-one |
|---|---|
| PubChem CID | 11735589 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (3S,4S)-4-cyclohexyl-3,4-dihydroxybutan-2-one |
| SMILES | CC(=O)[C@@H](O)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C10H18O3/c1-7(11)9(12)10(13)8-5-3-2-4-6-8/h8-10,12-13H,2-6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | LLSZPGFAJULSES-ZJUUUORDSA-N |
| XLogP | 0.88 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |