C12H16ClNO2 — CID 117356258
3-chloro-5-methyl-4-(2-methylpyrrolidin-2-yl)benzene-1,2-diol (PubChem CID 117356258) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 3-chloro-5-methyl-4-(2-methylpyrrolidin-2-yl)benzene-1,2-diol.
| Compound Name | 3-chloro-5-methyl-4-(2-methylpyrrolidin-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117356258 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 3-chloro-5-methyl-4-(2-methylpyrrolidin-2-yl)benzene-1,2-diol |
| SMILES | Cc1cc(O)c(O)c(Cl)c1C1(C)CCCN1 |
| InChI | InChI=1S/C12H16ClNO2/c1-7-6-8(15)11(16)10(13)9(7)12(2)4-3-5-14-12/h6,14-16H,3-5H2,1-2H3 |
| InChIKey | NFUWLKSPZKGWNL-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|