C8H14O5 — CID 11735637
(5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one (PubChem CID 11735637) has the molecular formula C8H14O5 and a molecular weight of 190.19 g/mol. Its IUPAC name is (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one.
| Compound Name | (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
|---|---|
| PubChem CID | 11735637 |
| Molecular Formula | C8H14O5 |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.08 |
| IUPAC Name | (5R,6R)-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-one |
| SMILES | CO[C@]1(C)OCC(=O)O[C@@]1(C)OC |
| InChI | InChI=1S/C8H14O5/c1-7(10-3)8(2,11-4)13-6(9)5-12-7/h5H2,1-4H3/t7-,8-/m1/s1 |
| InChIKey | JGTHYIWENNOLMX-HTQZYQBOSA-N |
| XLogP | 0.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |