About heptan-2-yl 2-chloroacetate
heptan-2-yl 2-chloroacetate (PubChem CID 11735680) has the molecular formula C9H17ClO2
and a molecular weight of 192.69 g/mol. Its IUPAC name is heptan-2-yl 2-chloroacetate.
Molecular Properties
| Compound Name | heptan-2-yl 2-chloroacetate |
| PubChem CID | 11735680 |
| Molecular Formula | C9H17ClO2 |
| Molecular Weight | 192.69 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | heptan-2-yl 2-chloroacetate |
| SMILES | CCCCCC(C)OC(=O)CCl |
| InChI | InChI=1S/C9H17ClO2/c1-3-4-5-6-8(2)12-9(11)7-10/h8H,3-7H2,1-2H3 |
| InChIKey | GKOMRSJNZZXVMU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.69 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze heptan-2-yl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptan-2-yl 2-chloroacetate?
The IUPAC name of heptan-2-yl 2-chloroacetate (CID 11735680) is heptan-2-yl 2-chloroacetate.
What is the SMILES notation for heptan-2-yl 2-chloroacetate?
The canonical SMILES for heptan-2-yl 2-chloroacetate is CCCCCC(C)OC(=O)CCl.
What is the InChIKey of heptan-2-yl 2-chloroacetate?
The InChIKey is GKOMRSJNZZXVMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17ClO2/c1-3-4-5-6-8(2)12-9(11)7-10/h8H,3-7H2,1-2H3.
What are the key properties of heptan-2-yl 2-chloroacetate?
heptan-2-yl 2-chloroacetate has a molecular weight of 192.69 g/mol, XLogP of 2.74, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for heptan-2-yl 2-chloroacetate is sourced from PubChem (CID 11735680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).