About [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol
[(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol (PubChem CID 11735761) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol |
| PubChem CID | 11735761 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol |
| SMILES | CC(C)=CCC[C@H](C)C[C@H]1O[C@@H]1CO |
| InChI | InChI=1S/C12H22O2/c1-9(2)5-4-6-10(3)7-11-12(8-13)14-11/h5,10-13H,4,6-8H2,1-3H3/t10-,11+,12+/m0/s1 |
| InChIKey | VZNJXSSQLOFXGA-QJPTWQEYSA-N |
| XLogP | 2.52 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol?
The IUPAC name of [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol (CID 11735761) is [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol.
What is the SMILES notation for [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol?
The canonical SMILES for [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol is CC(C)=CCC[C@H](C)C[C@H]1O[C@@H]1CO.
What is the InChIKey of [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol?
The InChIKey is VZNJXSSQLOFXGA-QJPTWQEYSA-N. The full InChI is InChI=1S/C12H22O2/c1-9(2)5-4-6-10(3)7-11-12(8-13)14-11/h5,10-13H,4,6-8H2,1-3H3/t10-,11+,12+/m0/s1.
What are the key properties of [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol?
[(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol has a molecular weight of 198.31 g/mol, XLogP of 2.52, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-3-[(2S)-2,6-dimethylhept-5-enyl]oxiran-2-yl]methanol is sourced from PubChem (CID 11735761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).