C14H18N4 — CID 117358203
5-[2-(pyrrolidin-1-ylmethyl)phenyl]-1H-pyrazol-3-amine (PubChem CID 117358203) has the molecular formula C14H18N4 and a molecular weight of 242.33 g/mol. Its IUPAC name is 5-[2-(pyrrolidin-1-ylmethyl)phenyl]-1H-pyrazol-3-amine.
| Compound Name | 5-[2-(pyrrolidin-1-ylmethyl)phenyl]-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 117358203 |
| Molecular Formula | C14H18N4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 5-[2-(pyrrolidin-1-ylmethyl)phenyl]-1H-pyrazol-3-amine |
| SMILES | Nc1cc(-c2ccccc2CN2CCCC2)[nH]n1 |
| InChI | InChI=1S/C14H18N4/c15-14-9-13(16-17-14)12-6-2-1-5-11(12)10-18-7-3-4-8-18/h1-2,5-6,9H,3-4,7-8,10H2,(H3,15,16,17) |
| InChIKey | ZOVRZXLDHSIWKO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 57.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |