C11H14O4 — CID 11735956
(1S,5R,6S)-5-hydroxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 11735956) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (1S,5R,6S)-5-hydroxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6S)-5-hydroxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 11735956 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (1S,5R,6S)-5-hydroxy-3-[(E)-3-hydroxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | CC(C)(O)/C=C/C1=C[C@@H](O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C11H14O4/c1-11(2,14)4-3-6-5-7(12)9-10(15-9)8(6)13/h3-5,7,9-10,12,14H,1-2H3/b4-3+/t7-,9+,10-/m1/s1 |
| InChIKey | GBMBXOXGPSTVDC-YFTHNKSASA-N |
| XLogP | -0.05 |
| TPSA | 70.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|