C13H13N3O2 — CID 117359646
7-(3-amino-1,2-oxazol-5-yl)-1-methyl-3,4-dihydroquinolin-2-one (PubChem CID 117359646) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 7-(3-amino-1,2-oxazol-5-yl)-1-methyl-3,4-dihydroquinolin-2-one.
| Compound Name | 7-(3-amino-1,2-oxazol-5-yl)-1-methyl-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 117359646 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 7-(3-amino-1,2-oxazol-5-yl)-1-methyl-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2ccc(-c3cc(N)no3)cc21 |
| InChI | InChI=1S/C13H13N3O2/c1-16-10-6-9(11-7-12(14)15-18-11)3-2-8(10)4-5-13(16)17/h2-3,6-7H,4-5H2,1H3,(H2,14,15) |
| InChIKey | UGJVVOSCGZFNDP-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |