C12H18FNO3 — CID 117359836
1-[4-fluoro-2-methoxy-6-(methoxymethyl)phenyl]-2-(methylamino)ethanol (PubChem CID 117359836) has the molecular formula C12H18FNO3 and a molecular weight of 243.28 g/mol. Its IUPAC name is 1-[4-fluoro-2-methoxy-6-(methoxymethyl)phenyl]-2-(methylamino)ethanol.
| Compound Name | 1-[4-fluoro-2-methoxy-6-(methoxymethyl)phenyl]-2-(methylamino)ethanol |
|---|---|
| PubChem CID | 117359836 |
| Molecular Formula | C12H18FNO3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 1-[4-fluoro-2-methoxy-6-(methoxymethyl)phenyl]-2-(methylamino)ethanol |
| SMILES | CNCC(O)c1c(COC)cc(F)cc1OC |
| InChI | InChI=1S/C12H18FNO3/c1-14-6-10(15)12-8(7-16-2)4-9(13)5-11(12)17-3/h4-5,10,14-15H,6-7H2,1-3H3 |
| InChIKey | XMBNUXDCFNTGCI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |