C11H16O2S — CID 11736003
3,3-diethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine (PubChem CID 11736003) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 3,3-diethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine.
| Compound Name | 3,3-diethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
|---|---|
| PubChem CID | 11736003 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 3,3-diethyl-2,4-dihydrothieno[3,4-b][1,4]dioxepine |
| SMILES | CCC1(CC)COc2cscc2OC1 |
| InChI | InChI=1S/C11H16O2S/c1-3-11(4-2)7-12-9-5-14-6-10(9)13-8-11/h5-6H,3-4,7-8H2,1-2H3 |
| InChIKey | HMKHKPKUPVRLOW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |