About 2-iodo-5-methylpyridine
2-iodo-5-methylpyridine (PubChem CID 11736116) has the molecular formula C6H6IN
and a molecular weight of 219.03 g/mol. Its IUPAC name is 2-iodo-5-methylpyridine.
Molecular Properties
| Compound Name | 2-iodo-5-methylpyridine |
| PubChem CID | 11736116 |
| Molecular Formula | C6H6IN |
| Molecular Weight | 219.03 g/mol |
| Exact Mass | 218.95 |
| IUPAC Name | 2-iodo-5-methylpyridine |
| SMILES | Cc1ccc(I)nc1 |
| InChI | InChI=1S/C6H6IN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3 |
| InChIKey | XOODLNRDHSTOQJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.03 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-5-methylpyridine?
The IUPAC name of 2-iodo-5-methylpyridine (CID 11736116) is 2-iodo-5-methylpyridine.
What is the SMILES notation for 2-iodo-5-methylpyridine?
The canonical SMILES for 2-iodo-5-methylpyridine is Cc1ccc(I)nc1.
What is the InChIKey of 2-iodo-5-methylpyridine?
The InChIKey is XOODLNRDHSTOQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6IN/c1-5-2-3-6(7)8-4-5/h2-4H,1H3.
What are the key properties of 2-iodo-5-methylpyridine?
2-iodo-5-methylpyridine has a molecular weight of 219.03 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-5-methylpyridine is sourced from PubChem (CID 11736116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).