About (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one
(3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one (PubChem CID 11736135) has the molecular formula C10H11F3O2
and a molecular weight of 220.19 g/mol. Its IUPAC name is (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one.
Molecular Properties
| Compound Name | (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one |
| PubChem CID | 11736135 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one |
| SMILES | O=C1OC2(CCCCC2)/C1=C/C(F)(F)F |
| InChI | InChI=1S/C10H11F3O2/c11-10(12,13)6-7-8(14)15-9(7)4-2-1-3-5-9/h6H,1-5H2/b7-6+ |
| InChIKey | XHQPSNGIDSVGAK-VOTSOKGWSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one?
The IUPAC name of (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one (CID 11736135) is (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one.
What is the SMILES notation for (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one?
The canonical SMILES for (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one is O=C1OC2(CCCCC2)/C1=C/C(F)(F)F.
What is the InChIKey of (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one?
The InChIKey is XHQPSNGIDSVGAK-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H11F3O2/c11-10(12,13)6-7-8(14)15-9(7)4-2-1-3-5-9/h6H,1-5H2/b7-6+.
What are the key properties of (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one?
(3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one has a molecular weight of 220.19 g/mol, XLogP of 2.73, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(2,2,2-trifluoroethylidene)-1-oxaspiro[3.5]nonan-2-one is sourced from PubChem (CID 11736135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).