About 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole
5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole (PubChem CID 11736346) has the molecular formula C12H23NO3
and a molecular weight of 229.32 g/mol. Its IUPAC name is 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 11736346 |
| Molecular Formula | C12H23NO3 |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.17 |
| IUPAC Name | 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole |
| SMILES | CCCC1=NOC(CC(OCC)OCC)C1 |
| InChI | InChI=1S/C12H23NO3/c1-4-7-10-8-11(16-13-10)9-12(14-5-2)15-6-3/h11-12H,4-9H2,1-3H3 |
| InChIKey | YHUVYRPGDRYIQO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole (CID 11736346) is 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole is CCCC1=NOC(CC(OCC)OCC)C1.
What is the InChIKey of 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole?
The InChIKey is YHUVYRPGDRYIQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-4-7-10-8-11(16-13-10)9-12(14-5-2)15-6-3/h11-12H,4-9H2,1-3H3.
What are the key properties of 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole?
5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole has a molecular weight of 229.32 g/mol, XLogP of 2.72, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,2-diethoxyethyl)-3-propyl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 11736346), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).