About ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate
ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate (PubChem CID 11736360) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate.
Molecular Properties
| Compound Name | ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate |
| PubChem CID | 11736360 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate |
| SMILES | CCOC(=O)C(C)C(=O)CC(C)(O)C(C)=O |
| InChI | InChI=1S/C11H18O5/c1-5-16-10(14)7(2)9(13)6-11(4,15)8(3)12/h7,15H,5-6H2,1-4H3 |
| InChIKey | HRIZJSJRBJVRKE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate?
The IUPAC name of ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate (CID 11736360) is ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate.
What is the SMILES notation for ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate?
The canonical SMILES for ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate is CCOC(=O)C(C)C(=O)CC(C)(O)C(C)=O.
What is the InChIKey of ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate?
The InChIKey is HRIZJSJRBJVRKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O5/c1-5-16-10(14)7(2)9(13)6-11(4,15)8(3)12/h7,15H,5-6H2,1-4H3.
What are the key properties of ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate?
ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate has a molecular weight of 230.26 g/mol, XLogP of 0.48, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxy-2,5-dimethyl-3,6-dioxoheptanoate is sourced from PubChem (CID 11736360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).