C10H9N3O4 — CID 11736475
ethyl 3-nitroimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 11736475) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is ethyl 3-nitroimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 3-nitroimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 11736475 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | ethyl 3-nitroimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9N3O4/c1-2-17-10(14)8-9(13(15)16)12-6-4-3-5-7(12)11-8/h3-6H,2H2,1H3 |
| InChIKey | MYRXPQNHKXKXMD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|