C10H20O2S2 — CID 11736515
(2R,3S,4S)-4-(1,3-dithian-2-yl)-2-methylpentane-1,3-diol (PubChem CID 11736515) has the molecular formula C10H20O2S2 and a molecular weight of 236.40 g/mol. Its IUPAC name is (2R,3S,4S)-4-(1,3-dithian-2-yl)-2-methylpentane-1,3-diol.
| Compound Name | (2R,3S,4S)-4-(1,3-dithian-2-yl)-2-methylpentane-1,3-diol |
|---|---|
| PubChem CID | 11736515 |
| Molecular Formula | C10H20O2S2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | (2R,3S,4S)-4-(1,3-dithian-2-yl)-2-methylpentane-1,3-diol |
| SMILES | C[C@H](CO)[C@H](O)[C@H](C)C1SCCCS1 |
| InChI | InChI=1S/C10H20O2S2/c1-7(6-11)9(12)8(2)10-13-4-3-5-14-10/h7-12H,3-6H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | LDHWPIKFBCVRLA-VGMNWLOBSA-N |
| XLogP | 1.81 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |