C15H19NO2 — CID 117365379
3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyrrolidine (PubChem CID 117365379) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyrrolidine.
| Compound Name | 3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyrrolidine |
|---|---|
| PubChem CID | 117365379 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 3-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyrrolidine |
| SMILES | c1cc2c(cc1C1CCNC1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C15H19NO2/c1-2-7-15(6-1)17-13-4-3-11(9-14(13)18-15)12-5-8-16-10-12/h3-4,9,12,16H,1-2,5-8,10H2 |
| InChIKey | CJKPEXRFZAPNDO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |