About 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine
4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine (PubChem CID 117365382) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine.
Molecular Properties
| Compound Name | 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine |
| PubChem CID | 117365382 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine |
| SMILES | c1cc2c(cc1C1CCNCC1)OC1(CCC1)O2 |
| InChI | InChI=1S/C15H19NO2/c1-6-15(7-1)17-13-3-2-12(10-14(13)18-15)11-4-8-16-9-5-11/h2-3,10-11,16H,1,4-9H2 |
| InChIKey | GVMQXSPMAMPDHO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine?
The IUPAC name of 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine (CID 117365382) is 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine.
What is the SMILES notation for 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine?
The canonical SMILES for 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine is c1cc2c(cc1C1CCNCC1)OC1(CCC1)O2.
What is the InChIKey of 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine?
The InChIKey is GVMQXSPMAMPDHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO2/c1-6-15(7-1)17-13-3-2-12(10-14(13)18-15)11-4-8-16-9-5-11/h2-3,10-11,16H,1,4-9H2.
What are the key properties of 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine?
4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine has a molecular weight of 245.32 g/mol, XLogP of 2.81, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-spiro[1,3-benzodioxole-2,1'-cyclobutane]-5-ylpiperidine is sourced from PubChem (CID 117365382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).