About propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate
propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate (PubChem CID 11736576) has the molecular formula C13H21NO3
and a molecular weight of 239.31 g/mol. Its IUPAC name is propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate.
Molecular Properties
| Compound Name | propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate |
| PubChem CID | 11736576 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate |
| SMILES | CC(C)OC(=O)N[C@]12CC[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C13H21NO3/c1-8(2)17-11(16)14-13-6-5-9(7-10(13)15)12(13,3)4/h8-9H,5-7H2,1-4H3,(H,14,16)/t9-,13-/m1/s1 |
| InChIKey | GHOIKWVCHCWLAZ-NOZJJQNGSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate?
The IUPAC name of propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate (CID 11736576) is propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate.
What is the SMILES notation for propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate?
The canonical SMILES for propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate is CC(C)OC(=O)N[C@]12CC[C@H](CC1=O)C2(C)C.
What is the InChIKey of propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate?
The InChIKey is GHOIKWVCHCWLAZ-NOZJJQNGSA-N. The full InChI is InChI=1S/C13H21NO3/c1-8(2)17-11(16)14-13-6-5-9(7-10(13)15)12(13,3)4/h8-9H,5-7H2,1-4H3,(H,14,16)/t9-,13-/m1/s1.
What are the key properties of propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate?
propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate has a molecular weight of 239.31 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl N-[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]carbamate is sourced from PubChem (CID 11736576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).