About (3S)-3-hydroxy-1,4-diphenylbutan-2-one
(3S)-3-hydroxy-1,4-diphenylbutan-2-one (PubChem CID 11736592) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is (3S)-3-hydroxy-1,4-diphenylbutan-2-one.
Molecular Properties
| Compound Name | (3S)-3-hydroxy-1,4-diphenylbutan-2-one |
| PubChem CID | 11736592 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | (3S)-3-hydroxy-1,4-diphenylbutan-2-one |
| SMILES | O=C(Cc1ccccc1)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16O2/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/t15-/m0/s1 |
| InChIKey | MOLCLXHQJKJETK-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-3-hydroxy-1,4-diphenylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-hydroxy-1,4-diphenylbutan-2-one?
The IUPAC name of (3S)-3-hydroxy-1,4-diphenylbutan-2-one (CID 11736592) is (3S)-3-hydroxy-1,4-diphenylbutan-2-one.
What is the SMILES notation for (3S)-3-hydroxy-1,4-diphenylbutan-2-one?
The canonical SMILES for (3S)-3-hydroxy-1,4-diphenylbutan-2-one is O=C(Cc1ccccc1)[C@@H](O)Cc1ccccc1.
What is the InChIKey of (3S)-3-hydroxy-1,4-diphenylbutan-2-one?
The InChIKey is MOLCLXHQJKJETK-HNNXBMFYSA-N. The full InChI is InChI=1S/C16H16O2/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/t15-/m0/s1.
What are the key properties of (3S)-3-hydroxy-1,4-diphenylbutan-2-one?
(3S)-3-hydroxy-1,4-diphenylbutan-2-one has a molecular weight of 240.30 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-hydroxy-1,4-diphenylbutan-2-one is sourced from PubChem (CID 11736592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).