About 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one
11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one (PubChem CID 11736697) has the molecular formula C9H9BrO3
and a molecular weight of 245.07 g/mol. Its IUPAC name is 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one.
Molecular Properties
| Compound Name | 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
| PubChem CID | 11736697 |
| Molecular Formula | C9H9BrO3 |
| Molecular Weight | 245.07 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one |
| SMILES | O=C1C=CC2(OCCCO2)C(Br)=C1 |
| InChI | InChI=1S/C9H9BrO3/c10-8-6-7(11)2-3-9(8)12-4-1-5-13-9/h2-3,6H,1,4-5H2 |
| InChIKey | XDXBXDGYZXNMDB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.07 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The IUPAC name of 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one (CID 11736697) is 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one.
What is the SMILES notation for 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The canonical SMILES for 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one is O=C1C=CC2(OCCCO2)C(Br)=C1.
What is the InChIKey of 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
The InChIKey is XDXBXDGYZXNMDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO3/c10-8-6-7(11)2-3-9(8)12-4-1-5-13-9/h2-3,6H,1,4-5H2.
What are the key properties of 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one?
11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one has a molecular weight of 245.07 g/mol, XLogP of 1.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-bromo-1,5-dioxaspiro[5.5]undeca-7,10-dien-9-one is sourced from PubChem (CID 11736697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).