C13H26O4 — CID 11736724
methyl (4R,6S,7S,8R)-7,9-dihydroxy-4,6,8-trimethylnonanoate (PubChem CID 11736724) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is methyl (4R,6S,7S,8R)-7,9-dihydroxy-4,6,8-trimethylnonanoate.
| Compound Name | methyl (4R,6S,7S,8R)-7,9-dihydroxy-4,6,8-trimethylnonanoate |
|---|---|
| PubChem CID | 11736724 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | methyl (4R,6S,7S,8R)-7,9-dihydroxy-4,6,8-trimethylnonanoate |
| SMILES | COC(=O)CC[C@@H](C)C[C@H](C)[C@H](O)[C@H](C)CO |
| InChI | InChI=1S/C13H26O4/c1-9(5-6-12(15)17-4)7-10(2)13(16)11(3)8-14/h9-11,13-14,16H,5-8H2,1-4H3/t9-,10+,11-,13+/m1/s1 |
| InChIKey | FIIYBRIFYSEKGB-XZUYRWCXSA-N |
| XLogP | 1.59 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |