C16H22O2 — CID 11736726
(5aS,6Z,11aS)-3,3-dimethyl-2,4,5a,8,9,10,11,11a-octahydrocycloocta[b][1]benzofuran-1-one (PubChem CID 11736726) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (5aS,6Z,11aS)-3,3-dimethyl-2,4,5a,8,9,10,11,11a-octahydrocycloocta[b][1]benzofuran-1-one.
| Compound Name | (5aS,6Z,11aS)-3,3-dimethyl-2,4,5a,8,9,10,11,11a-octahydrocycloocta[b][1]benzofuran-1-one |
|---|---|
| PubChem CID | 11736726 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (5aS,6Z,11aS)-3,3-dimethyl-2,4,5a,8,9,10,11,11a-octahydrocycloocta[b][1]benzofuran-1-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)O[C@H]1/C=C\CCCC[C@@H]21 |
| InChI | InChI=1S/C16H22O2/c1-16(2)9-12(17)15-11-7-5-3-4-6-8-13(11)18-14(15)10-16/h6,8,11,13H,3-5,7,9-10H2,1-2H3/b8-6-/t11-,13+/m1/s1 |
| InChIKey | KYGZNFPPRUSJNW-RXVTVFCNSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|