About 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione
1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione (PubChem CID 11736803) has the molecular formula C16H10O3
and a molecular weight of 250.25 g/mol. Its IUPAC name is 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione.
Molecular Properties
| Compound Name | 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione |
| PubChem CID | 11736803 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione |
| SMILES | O=C1c2ccccc2C(=O)C2(c3ccccc3)OC12 |
| InChI | InChI=1S/C16H10O3/c17-13-11-8-4-5-9-12(11)14(18)16(15(13)19-16)10-6-2-1-3-7-10/h1-9,15H |
| InChIKey | NLSNAKRUDIWZPO-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione?
The IUPAC name of 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione (CID 11736803) is 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione.
What is the SMILES notation for 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione?
The canonical SMILES for 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione is O=C1c2ccccc2C(=O)C2(c3ccccc3)OC12.
What is the InChIKey of 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione?
The InChIKey is NLSNAKRUDIWZPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10O3/c17-13-11-8-4-5-9-12(11)14(18)16(15(13)19-16)10-6-2-1-3-7-10/h1-9,15H.
What are the key properties of 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione?
1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione has a molecular weight of 250.25 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1a-phenyl-7aH-naphtho[2,3-b]oxirene-2,7-dione is sourced from PubChem (CID 11736803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).