About 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine
1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine (PubChem CID 117368389) has the molecular formula C15H19FN2
and a molecular weight of 246.33 g/mol. Its IUPAC name is 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine.
Molecular Properties
| Compound Name | 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine |
| PubChem CID | 117368389 |
| Molecular Formula | C15H19FN2 |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine |
| SMILES | Cc1cn(C)c2c(F)cc(C3(C(C)N)CC3)cc12 |
| InChI | InChI=1S/C15H19FN2/c1-9-8-18(3)14-12(9)6-11(7-13(14)16)15(4-5-15)10(2)17/h6-8,10H,4-5,17H2,1-3H3 |
| InChIKey | HPYHCLXRCPKFKQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine?
The IUPAC name of 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine (CID 117368389) is 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine.
What is the SMILES notation for 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine?
The canonical SMILES for 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine is Cc1cn(C)c2c(F)cc(C3(C(C)N)CC3)cc12.
What is the InChIKey of 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine?
The InChIKey is HPYHCLXRCPKFKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19FN2/c1-9-8-18(3)14-12(9)6-11(7-13(14)16)15(4-5-15)10(2)17/h6-8,10H,4-5,17H2,1-3H3.
What are the key properties of 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine?
1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine has a molecular weight of 246.33 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(7-fluoro-1,3-dimethylindol-5-yl)cyclopropyl]ethanamine is sourced from PubChem (CID 117368389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).