About 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol
8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol (PubChem CID 117369734) has the molecular formula C13H13NO4
and a molecular weight of 247.25 g/mol. Its IUPAC name is 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol.
Molecular Properties
| Compound Name | 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol |
| PubChem CID | 117369734 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol |
| SMILES | CNCC(O)c1c2ccoc2c(O)c2ccoc12 |
| InChI | InChI=1S/C13H13NO4/c1-14-6-9(15)10-7-2-4-18-13(7)11(16)8-3-5-17-12(8)10/h2-5,9,14-16H,6H2,1H3 |
| InChIKey | XSHOKZXIXSRHRS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol?
The IUPAC name of 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol (CID 117369734) is 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol.
What is the SMILES notation for 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol?
The canonical SMILES for 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol is CNCC(O)c1c2ccoc2c(O)c2ccoc12.
What is the InChIKey of 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol?
The InChIKey is XSHOKZXIXSRHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO4/c1-14-6-9(15)10-7-2-4-18-13(7)11(16)8-3-5-17-12(8)10/h2-5,9,14-16H,6H2,1H3.
What are the key properties of 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol?
8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol has a molecular weight of 247.25 g/mol, XLogP of 2.14, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[1-hydroxy-2-(methylamino)ethyl]furo[2,3-f][1]benzofuran-4-ol is sourced from PubChem (CID 117369734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).