C13H13NO4 — CID 117369779
8-(isocyanatomethyl)-4-methoxy-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran (PubChem CID 117369779) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 8-(isocyanatomethyl)-4-methoxy-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran.
| Compound Name | 8-(isocyanatomethyl)-4-methoxy-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran |
|---|---|
| PubChem CID | 117369779 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 8-(isocyanatomethyl)-4-methoxy-2,3,6,7-tetrahydrofuro[2,3-f][1]benzofuran |
| SMILES | COc1c2c(c(CN=C=O)c3c1OCC3)OCC2 |
| InChI | InChI=1S/C13H13NO4/c1-16-12-9-3-5-17-11(9)10(6-14-7-15)8-2-4-18-13(8)12/h2-6H2,1H3 |
| InChIKey | QTQJUVONHJFKPJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|