C12H9NO3S — CID 117370123
6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one (PubChem CID 117370123) has the molecular formula C12H9NO3S and a molecular weight of 247.27 g/mol. Its IUPAC name is 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one.
| Compound Name | 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one |
|---|---|
| PubChem CID | 117370123 |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one |
| SMILES | O=C=NC1(c2ccc3sc(=O)oc3c2)CCC1 |
| InChI | InChI=1S/C12H9NO3S/c14-7-13-12(4-1-5-12)8-2-3-10-9(6-8)16-11(15)17-10/h2-3,6H,1,4-5H2 |
| InChIKey | UDQJEIHGJVHSJV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|