About 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one
6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one (PubChem CID 117370123) has the molecular formula C12H9NO3S
and a molecular weight of 247.27 g/mol. Its IUPAC name is 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one.
Molecular Properties
| Compound Name | 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one |
| PubChem CID | 117370123 |
| Molecular Formula | C12H9NO3S |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.03 |
| IUPAC Name | 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one |
| SMILES | O=C=NC1(c2ccc3sc(=O)oc3c2)CCC1 |
| InChI | InChI=1S/C12H9NO3S/c14-7-13-12(4-1-5-12)8-2-3-10-9(6-8)16-11(15)17-10/h2-3,6H,1,4-5H2 |
| InChIKey | UDQJEIHGJVHSJV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one?
The IUPAC name of 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one (CID 117370123) is 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one.
What is the SMILES notation for 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one?
The canonical SMILES for 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one is O=C=NC1(c2ccc3sc(=O)oc3c2)CCC1.
What is the InChIKey of 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one?
The InChIKey is UDQJEIHGJVHSJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3S/c14-7-13-12(4-1-5-12)8-2-3-10-9(6-8)16-11(15)17-10/h2-3,6H,1,4-5H2.
What are the key properties of 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one?
6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one has a molecular weight of 247.27 g/mol, XLogP of 2.57, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(1-isocyanatocyclobutyl)-1,3-benzoxathiol-2-one is sourced from PubChem (CID 117370123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).