C12H22O6 — CID 11737094
ethyl (E,5S)-6-hydroxy-5-(2-methoxyethoxymethoxy)hex-2-enoate (PubChem CID 11737094) has the molecular formula C12H22O6 and a molecular weight of 262.30 g/mol. Its IUPAC name is ethyl (E,5S)-6-hydroxy-5-(2-methoxyethoxymethoxy)hex-2-enoate.
| Compound Name | ethyl (E,5S)-6-hydroxy-5-(2-methoxyethoxymethoxy)hex-2-enoate |
|---|---|
| PubChem CID | 11737094 |
| Molecular Formula | C12H22O6 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl (E,5S)-6-hydroxy-5-(2-methoxyethoxymethoxy)hex-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@@H](CO)OCOCCOC |
| InChI | InChI=1S/C12H22O6/c1-3-17-12(14)6-4-5-11(9-13)18-10-16-8-7-15-2/h4,6,11,13H,3,5,7-10H2,1-2H3/b6-4+/t11-/m0/s1 |
| InChIKey | SWWBDIKDKNLWIV-MALLOTDXSA-N |
| XLogP | 0.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|