C16H24O3 — CID 11737155
[(2R,3R)-3-[(E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enyl]oxiran-2-yl]methanol (PubChem CID 11737155) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is [(2R,3R)-3-[(E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2R,3R)-3-[(E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 11737155 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | [(2R,3R)-3-[(E)-2-methyl-3-[(2S,6S)-4-methylidene-6-prop-2-enyloxan-2-yl]prop-2-enyl]oxiran-2-yl]methanol |
| SMILES | C=CC[C@H]1CC(=C)C[C@@H](/C=C(\C)C[C@H]2O[C@@H]2CO)O1 |
| InChI | InChI=1S/C16H24O3/c1-4-5-13-6-11(2)7-14(18-13)8-12(3)9-15-16(10-17)19-15/h4,8,13-17H,1-2,5-7,9-10H2,3H3/b12-8+/t13-,14-,15+,16+/m0/s1 |
| InChIKey | AUQAFUFAOCJABV-IKAVZUBFSA-N |
| XLogP | 2.76 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|