C11H12ClF2NO — CID 117372344
[1-(5-chloro-2,4-difluoro-3-methoxyphenyl)cyclopropyl]methanamine (PubChem CID 117372344) has the molecular formula C11H12ClF2NO and a molecular weight of 247.67 g/mol. Its IUPAC name is [1-(5-chloro-2,4-difluoro-3-methoxyphenyl)cyclopropyl]methanamine.
| Compound Name | [1-(5-chloro-2,4-difluoro-3-methoxyphenyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 117372344 |
| Molecular Formula | C11H12ClF2NO |
| Molecular Weight | 247.67 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | [1-(5-chloro-2,4-difluoro-3-methoxyphenyl)cyclopropyl]methanamine |
| SMILES | COc1c(F)c(Cl)cc(C2(CN)CC2)c1F |
| InChI | InChI=1S/C11H12ClF2NO/c1-16-10-8(13)6(4-7(12)9(10)14)11(5-15)2-3-11/h4H,2-3,5,15H2,1H3 |
| InChIKey | IHZUARDKPCZQDV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.67 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|