C13H21NO5 — CID 11737328
(2R,3R,4R,5S)-6-(benzylamino)hexane-1,2,3,4,5-pentol (PubChem CID 11737328) has the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. Its IUPAC name is (2R,3R,4R,5S)-6-(benzylamino)hexane-1,2,3,4,5-pentol.
| Compound Name | (2R,3R,4R,5S)-6-(benzylamino)hexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 11737328 |
| Molecular Formula | C13H21NO5 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (2R,3R,4R,5S)-6-(benzylamino)hexane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)CNCc1ccccc1 |
| InChI | InChI=1S/C13H21NO5/c15-8-11(17)13(19)12(18)10(16)7-14-6-9-4-2-1-3-5-9/h1-5,10-19H,6-8H2/t10-,11+,12+,13+/m0/s1 |
| InChIKey | GXNAHMSFQNFFSO-UMSGYPCISA-N |
| XLogP | -1.79 |
| TPSA | 113.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |