C14H16O4 — CID 117373340
2-[2-(cyclopropylmethoxy)-3,5-dimethylphenyl]-2-oxoacetic acid (PubChem CID 117373340) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-[2-(cyclopropylmethoxy)-3,5-dimethylphenyl]-2-oxoacetic acid.
| Compound Name | 2-[2-(cyclopropylmethoxy)-3,5-dimethylphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117373340 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-[2-(cyclopropylmethoxy)-3,5-dimethylphenyl]-2-oxoacetic acid |
| SMILES | Cc1cc(C)c(OCC2CC2)c(C(=O)C(=O)O)c1 |
| InChI | InChI=1S/C14H16O4/c1-8-5-9(2)13(18-7-10-3-4-10)11(6-8)12(15)14(16)17/h5-6,10H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | MHYSNFOGPNLFEB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|