C13H16N2O3 — CID 117373475
1-[4-(2-hydroxyethyl)phenyl]-4-methylpiperazine-2,3-dione (PubChem CID 117373475) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)phenyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[4-(2-hydroxyethyl)phenyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 117373475 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)phenyl]-4-methylpiperazine-2,3-dione |
| SMILES | CN1CCN(c2ccc(CCO)cc2)C(=O)C1=O |
| InChI | InChI=1S/C13H16N2O3/c1-14-7-8-15(13(18)12(14)17)11-4-2-10(3-5-11)6-9-16/h2-5,16H,6-9H2,1H3 |
| InChIKey | BZOSPSLZEXALDG-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|