C12H9ClN2O2 — CID 117374900
5-chloro-7-(1-isocyanatocyclopropyl)-1,3-dihydroindol-2-one (PubChem CID 117374900) has the molecular formula C12H9ClN2O2 and a molecular weight of 248.67 g/mol. Its IUPAC name is 5-chloro-7-(1-isocyanatocyclopropyl)-1,3-dihydroindol-2-one.
| Compound Name | 5-chloro-7-(1-isocyanatocyclopropyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 117374900 |
| Molecular Formula | C12H9ClN2O2 |
| Molecular Weight | 248.67 g/mol |
| Exact Mass | 248.04 |
| IUPAC Name | 5-chloro-7-(1-isocyanatocyclopropyl)-1,3-dihydroindol-2-one |
| SMILES | O=C=NC1(c2cc(Cl)cc3c2NC(=O)C3)CC1 |
| InChI | InChI=1S/C12H9ClN2O2/c13-8-3-7-4-10(17)15-11(7)9(5-8)12(1-2-12)14-6-16/h3,5H,1-2,4H2,(H,15,17) |
| InChIKey | DGWRJBFRNNHIJM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.67 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|