C27H25FN2O4S — CID 1173768
5-(3,4-dimethoxyphenyl)-1-[2-(4-fluorophenyl)-2-oxoethyl]-6,7,8,9-tetrahydro-3H-[1]benzothiolo[2,3-e][1,4]diazepin-2-one (PubChem CID 1173768) has the molecular formula C27H25FN2O4S and a molecular weight of 492.57 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)-1-[2-(4-fluorophenyl)-2-oxoethyl]-6,7,8,9-tetrahydro-3H-[1]benzothiolo[2,3-e][1,4]diazepin-2-one.
| Compound Name | 5-(3,4-dimethoxyphenyl)-1-[2-(4-fluorophenyl)-2-oxoethyl]-6,7,8,9-tetrahydro-3H-[1]benzothiolo[2,3-e][1,4]diazepin-2-one |
|---|---|
| PubChem CID | 1173768 |
| Molecular Formula | C27H25FN2O4S |
| Molecular Weight | 492.57 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)-1-[2-(4-fluorophenyl)-2-oxoethyl]-6,7,8,9-tetrahydro-3H-[1]benzothiolo[2,3-e][1,4]diazepin-2-one |
| SMILES | COc1ccc(C2=NCC(=O)N(CC(=O)c3ccc(F)cc3)c3sc4c(c32)CCCC4)cc1OC |
| InChI | InChI=1S/C27H25FN2O4S/c1-33-21-12-9-17(13-22(21)34-2)26-25-19-5-3-4-6-23(19)35-27(25)30(24(32)14-29-26)15-20(31)16-7-10-18(28)11-8-16/h7-13H,3-6,14-15H2,1-2H3 |
| InChIKey | ZWJSXHHKJJXSGX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |